C20H19NO6S — CID 23857762
4-[furan-2-ylmethyl-[(3-methoxyphenyl)methyl]sulfamoyl]benzoic acid (PubChem CID 23857762) has the molecular formula C20H19NO6S and a molecular weight of 401.44 g/mol. Its IUPAC name is 4-[furan-2-ylmethyl-[(3-methoxyphenyl)methyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[furan-2-ylmethyl-[(3-methoxyphenyl)methyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 23857762 |
| Molecular Formula | C20H19NO6S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 4-[furan-2-ylmethyl-[(3-methoxyphenyl)methyl]sulfamoyl]benzoic acid |
| SMILES | COc1cccc(CN(Cc2ccco2)S(=O)(=O)c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C20H19NO6S/c1-26-17-5-2-4-15(12-17)13-21(14-18-6-3-11-27-18)28(24,25)19-9-7-16(8-10-19)20(22)23/h2-12H,13-14H2,1H3,(H,22,23) |
| InChIKey | GLFIXOWFUKONDS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |