C19H23NO6S — CID 10691967
ethyl 2-[(3-methoxyphenyl)methyl-(4-methoxyphenyl)sulfonylamino]acetate (PubChem CID 10691967) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is ethyl 2-[(3-methoxyphenyl)methyl-(4-methoxyphenyl)sulfonylamino]acetate.
| Compound Name | ethyl 2-[(3-methoxyphenyl)methyl-(4-methoxyphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 10691967 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | ethyl 2-[(3-methoxyphenyl)methyl-(4-methoxyphenyl)sulfonylamino]acetate |
| SMILES | CCOC(=O)CN(Cc1cccc(OC)c1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H23NO6S/c1-4-26-19(21)14-20(13-15-6-5-7-17(12-15)25-3)27(22,23)18-10-8-16(24-2)9-11-18/h5-12H,4,13-14H2,1-3H3 |
| InChIKey | UDCWFTKIDZNODS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |