C22H19F2NO5S — CID 25207453
4-[(3,4-difluorophenyl)methyl-[(3-methoxyphenyl)methyl]sulfamoyl]benzoic acid (PubChem CID 25207453) has the molecular formula C22H19F2NO5S and a molecular weight of 447.46 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)methyl-[(3-methoxyphenyl)methyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[(3,4-difluorophenyl)methyl-[(3-methoxyphenyl)methyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 25207453 |
| Molecular Formula | C22H19F2NO5S |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 4-[(3,4-difluorophenyl)methyl-[(3-methoxyphenyl)methyl]sulfamoyl]benzoic acid |
| SMILES | COc1cccc(CN(Cc2ccc(F)c(F)c2)S(=O)(=O)c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C22H19F2NO5S/c1-30-18-4-2-3-15(11-18)13-25(14-16-5-10-20(23)21(24)12-16)31(28,29)19-8-6-17(7-9-19)22(26)27/h2-12H,13-14H2,1H3,(H,26,27) |
| InChIKey | XBEFCVHVOCBWMV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |