C18H22FNO4S — CID 131936762
3-fluoro-N-[(3-methoxyphenyl)methyl]-N-(3-methoxypropyl)benzenesulfonamide (PubChem CID 131936762) has the molecular formula C18H22FNO4S and a molecular weight of 367.44 g/mol. Its IUPAC name is 3-fluoro-N-[(3-methoxyphenyl)methyl]-N-(3-methoxypropyl)benzenesulfonamide.
| Compound Name | 3-fluoro-N-[(3-methoxyphenyl)methyl]-N-(3-methoxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 131936762 |
| Molecular Formula | C18H22FNO4S |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 3-fluoro-N-[(3-methoxyphenyl)methyl]-N-(3-methoxypropyl)benzenesulfonamide |
| SMILES | COCCCN(Cc1cccc(OC)c1)S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H22FNO4S/c1-23-11-5-10-20(14-15-6-3-8-17(12-15)24-2)25(21,22)18-9-4-7-16(19)13-18/h3-4,6-9,12-13H,5,10-11,14H2,1-2H3 |
| InChIKey | KBUSPUNTPIAAIA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|