C16H18FNO4S2 — CID 55559480
N-ethyl-N-[(3-fluorophenyl)methyl]-3-methylsulfonylbenzenesulfonamide (PubChem CID 55559480) has the molecular formula C16H18FNO4S2 and a molecular weight of 371.46 g/mol. Its IUPAC name is N-ethyl-N-[(3-fluorophenyl)methyl]-3-methylsulfonylbenzenesulfonamide.
| Compound Name | N-ethyl-N-[(3-fluorophenyl)methyl]-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 55559480 |
| Molecular Formula | C16H18FNO4S2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-ethyl-N-[(3-fluorophenyl)methyl]-3-methylsulfonylbenzenesulfonamide |
| SMILES | CCN(Cc1cccc(F)c1)S(=O)(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H18FNO4S2/c1-3-18(12-13-6-4-7-14(17)10-13)24(21,22)16-9-5-8-15(11-16)23(2,19)20/h4-11H,3,12H2,1-2H3 |
| InChIKey | XCUUIURVSHSGIE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |