About 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3-methylphenyl)methyl]benzene-1,4-disulfonamide
4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3-methylphenyl)methyl]benzene-1,4-disulfonamide (PubChem CID 86983221) has the molecular formula C18H24N2O4S2
and a molecular weight of 396.53 g/mol. Its IUPAC name is 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3-methylphenyl)methyl]benzene-1,4-disulfonamide.
Molecular Properties
| Compound Name | 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3-methylphenyl)methyl]benzene-1,4-disulfonamide |
| PubChem CID | 86983221 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3-methylphenyl)methyl]benzene-1,4-disulfonamide |
| SMILES | CCN(Cc1cccc(C)c1)S(=O)(=O)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C18H24N2O4S2/c1-5-20(14-16-8-6-7-15(2)13-16)26(23,24)18-11-9-17(10-12-18)25(21,22)19(3)4/h6-13H,5,14H2,1-4H3 |
| InChIKey | WYUXNKQGWOFHQD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3-methylphenyl)methyl]benzene-1,4-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3-methylphenyl)methyl]benzene-1,4-disulfonamide?
The IUPAC name of 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3-methylphenyl)methyl]benzene-1,4-disulfonamide (CID 86983221) is 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3-methylphenyl)methyl]benzene-1,4-disulfonamide.
What is the SMILES notation for 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3-methylphenyl)methyl]benzene-1,4-disulfonamide?
The canonical SMILES for 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3-methylphenyl)methyl]benzene-1,4-disulfonamide is CCN(Cc1cccc(C)c1)S(=O)(=O)c1ccc(S(=O)(=O)N(C)C)cc1.
What is the InChIKey of 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3-methylphenyl)methyl]benzene-1,4-disulfonamide?
The InChIKey is WYUXNKQGWOFHQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O4S2/c1-5-20(14-16-8-6-7-15(2)13-16)26(23,24)18-11-9-17(10-12-18)25(21,22)19(3)4/h6-13H,5,14H2,1-4H3.
What are the key properties of 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3-methylphenyl)methyl]benzene-1,4-disulfonamide?
4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3-methylphenyl)methyl]benzene-1,4-disulfonamide has a molecular weight of 396.53 g/mol, XLogP of 2.46, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3-methylphenyl)methyl]benzene-1,4-disulfonamide is sourced from PubChem (CID 86983221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).