C15H16FNO4S2 — CID 31534239
N-[(3-fluorophenyl)methyl]-N-methyl-4-methylsulfonylbenzenesulfonamide (PubChem CID 31534239) has the molecular formula C15H16FNO4S2 and a molecular weight of 357.43 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N-methyl-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-N-methyl-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 31534239 |
| Molecular Formula | C15H16FNO4S2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N-methyl-4-methylsulfonylbenzenesulfonamide |
| SMILES | CN(Cc1cccc(F)c1)S(=O)(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H16FNO4S2/c1-17(11-12-4-3-5-13(16)10-12)23(20,21)15-8-6-14(7-9-15)22(2,18)19/h3-10H,11H2,1-2H3 |
| InChIKey | WEVLYMROTSFNNL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |