C17H22N2O4S2 — CID 31534668
N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-4-methylsulfonylbenzenesulfonamide (PubChem CID 31534668) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 31534668 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-4-methylsulfonylbenzenesulfonamide |
| SMILES | CN(C)c1ccc(CN(C)S(=O)(=O)c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-18(2)15-7-5-14(6-8-15)13-19(3)25(22,23)17-11-9-16(10-12-17)24(4,20)21/h5-12H,13H2,1-4H3 |
| InChIKey | GKZPVAPGLYBNIT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|