C13H17N3O4S2 — CID 134002545
N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-methylsulfonylbenzenesulfonamide (PubChem CID 134002545) has the molecular formula C13H17N3O4S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 134002545 |
| Molecular Formula | C13H17N3O4S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-methylsulfonylbenzenesulfonamide |
| SMILES | CN(Cc1cnn(C)c1)S(=O)(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H17N3O4S2/c1-15-9-11(8-14-15)10-16(2)22(19,20)13-6-4-12(5-7-13)21(3,17)18/h4-9H,10H2,1-3H3 |
| InChIKey | WGMAMNPBTNBJAJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |