C14H19N3O4S2 — CID 47812984
N-ethyl-N-[(1-methylpyrazol-4-yl)methyl]-4-methylsulfonylbenzenesulfonamide (PubChem CID 47812984) has the molecular formula C14H19N3O4S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is N-ethyl-N-[(1-methylpyrazol-4-yl)methyl]-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-ethyl-N-[(1-methylpyrazol-4-yl)methyl]-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 47812984 |
| Molecular Formula | C14H19N3O4S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-ethyl-N-[(1-methylpyrazol-4-yl)methyl]-4-methylsulfonylbenzenesulfonamide |
| SMILES | CCN(Cc1cnn(C)c1)S(=O)(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H19N3O4S2/c1-4-17(11-12-9-15-16(2)10-12)23(20,21)14-7-5-13(6-8-14)22(3,18)19/h5-10H,4,11H2,1-3H3 |
| InChIKey | GSFAXVCANNTGBP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |