C15H22N4O3S2 — CID 47083099
N-[1-[5-[ethyl-[(1-methylpyrazol-4-yl)methyl]sulfamoyl]thiophen-2-yl]ethyl]acetamide (PubChem CID 47083099) has the molecular formula C15H22N4O3S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-[1-[5-[ethyl-[(1-methylpyrazol-4-yl)methyl]sulfamoyl]thiophen-2-yl]ethyl]acetamide.
| Compound Name | N-[1-[5-[ethyl-[(1-methylpyrazol-4-yl)methyl]sulfamoyl]thiophen-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 47083099 |
| Molecular Formula | C15H22N4O3S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[1-[5-[ethyl-[(1-methylpyrazol-4-yl)methyl]sulfamoyl]thiophen-2-yl]ethyl]acetamide |
| SMILES | CCN(Cc1cnn(C)c1)S(=O)(=O)c1ccc(C(C)NC(C)=O)s1 |
| InChI | InChI=1S/C15H22N4O3S2/c1-5-19(10-13-8-16-18(4)9-13)24(21,22)15-7-6-14(23-15)11(2)17-12(3)20/h6-9,11H,5,10H2,1-4H3,(H,17,20) |
| InChIKey | JXFWOVKPWBYSPK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |