C15H22N4OS — CID 95129803
1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-3-[(1R)-2-methyl-1-thiophen-2-ylpropyl]urea (PubChem CID 95129803) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is 1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-3-[(1R)-2-methyl-1-thiophen-2-ylpropyl]urea.
| Compound Name | 1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-3-[(1R)-2-methyl-1-thiophen-2-ylpropyl]urea |
|---|---|
| PubChem CID | 95129803 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-3-[(1R)-2-methyl-1-thiophen-2-ylpropyl]urea |
| SMILES | CC(C)[C@@H](NC(=O)N(C)Cc1cnn(C)c1)c1cccs1 |
| InChI | InChI=1S/C15H22N4OS/c1-11(2)14(13-6-5-7-21-13)17-15(20)18(3)9-12-8-16-19(4)10-12/h5-8,10-11,14H,9H2,1-4H3,(H,17,20)/t14-/m1/s1 |
| InChIKey | MKRAMZIFYVJWQD-CQSZACIVSA-N |
| XLogP | 3.02 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |