C13H22N2OS — CID 115575874
1,1-diethyl-3-(2-methyl-1-thiophen-2-ylpropyl)urea (PubChem CID 115575874) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is 1,1-diethyl-3-(2-methyl-1-thiophen-2-ylpropyl)urea.
| Compound Name | 1,1-diethyl-3-(2-methyl-1-thiophen-2-ylpropyl)urea |
|---|---|
| PubChem CID | 115575874 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1,1-diethyl-3-(2-methyl-1-thiophen-2-ylpropyl)urea |
| SMILES | CCN(CC)C(=O)NC(c1cccs1)C(C)C |
| InChI | InChI=1S/C13H22N2OS/c1-5-15(6-2)13(16)14-12(10(3)4)11-8-7-9-17-11/h7-10,12H,5-6H2,1-4H3,(H,14,16) |
| InChIKey | ZXEDKBJQGFFFIH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |