C10H14BrNOS — CID 63681207
2-bromo-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide (PubChem CID 63681207) has the molecular formula C10H14BrNOS and a molecular weight of 276.20 g/mol. Its IUPAC name is 2-bromo-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide.
| Compound Name | 2-bromo-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide |
|---|---|
| PubChem CID | 63681207 |
| Molecular Formula | C10H14BrNOS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 2-bromo-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide |
| SMILES | CC(C)C(NC(=O)CBr)c1cccs1 |
| InChI | InChI=1S/C10H14BrNOS/c1-7(2)10(12-9(13)6-11)8-4-3-5-14-8/h3-5,7,10H,6H2,1-2H3,(H,12,13) |
| InChIKey | RWTHSOAHGVODCQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|