C17H24N2OS2 — CID 47023834
1,3-bis(2-methyl-1-thiophen-2-ylpropyl)urea (PubChem CID 47023834) has the molecular formula C17H24N2OS2 and a molecular weight of 336.53 g/mol. Its IUPAC name is 1,3-bis(2-methyl-1-thiophen-2-ylpropyl)urea.
| Compound Name | 1,3-bis(2-methyl-1-thiophen-2-ylpropyl)urea |
|---|---|
| PubChem CID | 47023834 |
| Molecular Formula | C17H24N2OS2 |
| Molecular Weight | 336.53 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1,3-bis(2-methyl-1-thiophen-2-ylpropyl)urea |
| SMILES | CC(C)C(NC(=O)NC(c1cccs1)C(C)C)c1cccs1 |
| InChI | InChI=1S/C17H24N2OS2/c1-11(2)15(13-7-5-9-21-13)18-17(20)19-16(12(3)4)14-8-6-10-22-14/h5-12,15-16H,1-4H3,(H2,18,19,20) |
| InChIKey | DFFXTJXGNWRBDP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |