C13H20N2O4S — CID 66177213
2-hydroxy-2-methyl-3-[(2-methyl-1-thiophen-2-ylpropyl)carbamoylamino]propanoic acid (PubChem CID 66177213) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-[(2-methyl-1-thiophen-2-ylpropyl)carbamoylamino]propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-[(2-methyl-1-thiophen-2-ylpropyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 66177213 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-hydroxy-2-methyl-3-[(2-methyl-1-thiophen-2-ylpropyl)carbamoylamino]propanoic acid |
| SMILES | CC(C)C(NC(=O)NCC(C)(O)C(=O)O)c1cccs1 |
| InChI | InChI=1S/C13H20N2O4S/c1-8(2)10(9-5-4-6-20-9)15-12(18)14-7-13(3,19)11(16)17/h4-6,8,10,19H,7H2,1-3H3,(H,16,17)(H2,14,15,18) |
| InChIKey | YNPSQWLPDWTIRP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |