C13H20N2O3S — CID 113308183
2,2-dimethyl-3-(1-thiophen-2-ylpropylcarbamoylamino)propanoic acid (PubChem CID 113308183) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 2,2-dimethyl-3-(1-thiophen-2-ylpropylcarbamoylamino)propanoic acid.
| Compound Name | 2,2-dimethyl-3-(1-thiophen-2-ylpropylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 113308183 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2,2-dimethyl-3-(1-thiophen-2-ylpropylcarbamoylamino)propanoic acid |
| SMILES | CCC(NC(=O)NCC(C)(C)C(=O)O)c1cccs1 |
| InChI | InChI=1S/C13H20N2O3S/c1-4-9(10-6-5-7-19-10)15-12(18)14-8-13(2,3)11(16)17/h5-7,9H,4,8H2,1-3H3,(H,16,17)(H2,14,15,18) |
| InChIKey | DILSEQIUQQGONY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |