C13H20N2O5 — CID 66177641
3-[4-(furan-2-yl)butan-2-ylcarbamoylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 66177641) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-[4-(furan-2-yl)butan-2-ylcarbamoylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[4-(furan-2-yl)butan-2-ylcarbamoylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66177641 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 3-[4-(furan-2-yl)butan-2-ylcarbamoylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(CCc1ccco1)NC(=O)NCC(C)(O)C(=O)O |
| InChI | InChI=1S/C13H20N2O5/c1-9(5-6-10-4-3-7-20-10)15-12(18)14-8-13(2,19)11(16)17/h3-4,7,9,19H,5-6,8H2,1-2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | AOIVPSUNAIYSNH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |