C14H19NO4 — CID 55169449
(Z)-4-[4-(furan-2-yl)butan-2-ylamino]-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 55169449) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (Z)-4-[4-(furan-2-yl)butan-2-ylamino]-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[4-(furan-2-yl)butan-2-ylamino]-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 55169449 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (Z)-4-[4-(furan-2-yl)butan-2-ylamino]-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | C/C(C(=O)O)=C(\C)C(=O)NC(C)CCc1ccco1 |
| InChI | InChI=1S/C14H19NO4/c1-9(6-7-12-5-4-8-19-12)15-13(16)10(2)11(3)14(17)18/h4-5,8-9H,6-7H2,1-3H3,(H,15,16)(H,17,18)/b11-10- |
| InChIKey | DADOUSRXKCBSKD-KHPPLWFESA-N |
| XLogP | 2.14 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|