C13H20N2O4 — CID 55096590
2-[4-(furan-2-yl)butan-2-ylcarbamoyl-methylamino]propanoic acid (PubChem CID 55096590) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)butan-2-ylcarbamoyl-methylamino]propanoic acid.
| Compound Name | 2-[4-(furan-2-yl)butan-2-ylcarbamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 55096590 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-[4-(furan-2-yl)butan-2-ylcarbamoyl-methylamino]propanoic acid |
| SMILES | CC(CCc1ccco1)NC(=O)N(C)C(C)C(=O)O |
| InChI | InChI=1S/C13H20N2O4/c1-9(6-7-11-5-4-8-19-11)14-13(18)15(3)10(2)12(16)17/h4-5,8-10H,6-7H2,1-3H3,(H,14,18)(H,16,17) |
| InChIKey | BJLKPJOOZSPFQZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |