C15H16FNOS — CID 9051637
4-fluoro-N-[(1R)-2-methyl-1-thiophen-2-ylpropyl]benzamide (PubChem CID 9051637) has the molecular formula C15H16FNOS and a molecular weight of 277.36 g/mol. Its IUPAC name is 4-fluoro-N-[(1R)-2-methyl-1-thiophen-2-ylpropyl]benzamide.
| Compound Name | 4-fluoro-N-[(1R)-2-methyl-1-thiophen-2-ylpropyl]benzamide |
|---|---|
| PubChem CID | 9051637 |
| Molecular Formula | C15H16FNOS |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-fluoro-N-[(1R)-2-methyl-1-thiophen-2-ylpropyl]benzamide |
| SMILES | CC(C)[C@@H](NC(=O)c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C15H16FNOS/c1-10(2)14(13-4-3-9-19-13)17-15(18)11-5-7-12(16)8-6-11/h3-10,14H,1-2H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | KKPOPAOTFGARSQ-CQSZACIVSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |