C21H29NO4S — CID 55397848
3,4,5-triethoxy-N-(2-methyl-1-thiophen-2-ylpropyl)benzamide (PubChem CID 55397848) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-(2-methyl-1-thiophen-2-ylpropyl)benzamide.
| Compound Name | 3,4,5-triethoxy-N-(2-methyl-1-thiophen-2-ylpropyl)benzamide |
|---|---|
| PubChem CID | 55397848 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 3,4,5-triethoxy-N-(2-methyl-1-thiophen-2-ylpropyl)benzamide |
| SMILES | CCOc1cc(C(=O)NC(c2cccs2)C(C)C)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H29NO4S/c1-6-24-16-12-15(13-17(25-7-2)20(16)26-8-3)21(23)22-19(14(4)5)18-10-9-11-27-18/h9-14,19H,6-8H2,1-5H3,(H,22,23) |
| InChIKey | GLWIZRLIDKRZTK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |