C14H24N2OS — CID 82848158
5-amino-N-(2-methyl-1-thiophen-2-ylpropyl)hexanamide (PubChem CID 82848158) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 5-amino-N-(2-methyl-1-thiophen-2-ylpropyl)hexanamide.
| Compound Name | 5-amino-N-(2-methyl-1-thiophen-2-ylpropyl)hexanamide |
|---|---|
| PubChem CID | 82848158 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 5-amino-N-(2-methyl-1-thiophen-2-ylpropyl)hexanamide |
| SMILES | CC(N)CCCC(=O)NC(c1cccs1)C(C)C |
| InChI | InChI=1S/C14H24N2OS/c1-10(2)14(12-7-5-9-18-12)16-13(17)8-4-6-11(3)15/h5,7,9-11,14H,4,6,8,15H2,1-3H3,(H,16,17) |
| InChIKey | QHLMZMVWONMKNV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |