C16H28N2OS — CID 65290946
6-amino-2-methyl-N-(2-methyl-1-thiophen-2-ylpropyl)heptanamide (PubChem CID 65290946) has the molecular formula C16H28N2OS and a molecular weight of 296.48 g/mol. Its IUPAC name is 6-amino-2-methyl-N-(2-methyl-1-thiophen-2-ylpropyl)heptanamide.
| Compound Name | 6-amino-2-methyl-N-(2-methyl-1-thiophen-2-ylpropyl)heptanamide |
|---|---|
| PubChem CID | 65290946 |
| Molecular Formula | C16H28N2OS |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 6-amino-2-methyl-N-(2-methyl-1-thiophen-2-ylpropyl)heptanamide |
| SMILES | CC(N)CCCC(C)C(=O)NC(c1cccs1)C(C)C |
| InChI | InChI=1S/C16H28N2OS/c1-11(2)15(14-9-6-10-20-14)18-16(19)12(3)7-5-8-13(4)17/h6,9-13,15H,5,7-8,17H2,1-4H3,(H,18,19) |
| InChIKey | OKOIAWQDVZLVSD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |