C12H20N2OS — CID 104685412
5-amino-2-methyl-N-[(1R)-1-thiophen-2-ylethyl]pentanamide (PubChem CID 104685412) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[(1R)-1-thiophen-2-ylethyl]pentanamide.
| Compound Name | 5-amino-2-methyl-N-[(1R)-1-thiophen-2-ylethyl]pentanamide |
|---|---|
| PubChem CID | 104685412 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 5-amino-2-methyl-N-[(1R)-1-thiophen-2-ylethyl]pentanamide |
| SMILES | CC(CCCN)C(=O)N[C@H](C)c1cccs1 |
| InChI | InChI=1S/C12H20N2OS/c1-9(5-3-7-13)12(15)14-10(2)11-6-4-8-16-11/h4,6,8-10H,3,5,7,13H2,1-2H3,(H,14,15)/t9?,10-/m1/s1 |
| InChIKey | OKYKURITSRJMCK-QVDQXJPCSA-N |
| XLogP | 2.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |