C19H27N3O3S — CID 51214574
4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-methyl-1-thiophen-2-ylpropyl)butanamide (PubChem CID 51214574) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-methyl-1-thiophen-2-ylpropyl)butanamide.
| Compound Name | 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-methyl-1-thiophen-2-ylpropyl)butanamide |
|---|---|
| PubChem CID | 51214574 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-methyl-1-thiophen-2-ylpropyl)butanamide |
| SMILES | CC(C)C(NC(=O)CCCN1C(=O)NC2(CCCC2)C1=O)c1cccs1 |
| InChI | InChI=1S/C19H27N3O3S/c1-13(2)16(14-7-6-12-26-14)20-15(23)8-5-11-22-17(24)19(21-18(22)25)9-3-4-10-19/h6-7,12-13,16H,3-5,8-11H2,1-2H3,(H,20,23)(H,21,25) |
| InChIKey | HIJBJXZQDUNOLF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|