C23H31N5O3 — CID 55430587
N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide (PubChem CID 55430587) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide |
|---|---|
| PubChem CID | 55430587 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide |
| SMILES | CC(C)CC(NC(=O)CCCN1C(=O)NC2(CCCC2)C1=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H31N5O3/c1-15(2)14-18(20-25-16-8-3-4-9-17(16)26-20)24-19(29)10-7-13-28-21(30)23(27-22(28)31)11-5-6-12-23/h3-4,8-9,15,18H,5-7,10-14H2,1-2H3,(H,24,29)(H,25,26)(H,27,31) |
| InChIKey | HBBINADYOKVERO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|