C20H27N5O3S — CID 27260273
N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 27260273) has the molecular formula C20H27N5O3S and a molecular weight of 417.54 g/mol. Its IUPAC name is N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 27260273 |
| Molecular Formula | C20H27N5O3S |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | CSCC[C@H](NC(=O)CCCN1C(=O)NC(C)(C)C1=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H27N5O3S/c1-20(2)18(27)25(19(28)24-20)11-6-9-16(26)21-15(10-12-29-3)17-22-13-7-4-5-8-14(13)23-17/h4-5,7-8,15H,6,9-12H2,1-3H3,(H,21,26)(H,22,23)(H,24,28)/t15-/m0/s1 |
| InChIKey | GDAYNFJSXDXZHR-HNNXBMFYSA-N |
| XLogP | 2.58 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|