C16H26Cl2N4OS — CID 119855271
N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-(methylamino)butanamide;dihydrochloride (PubChem CID 119855271) has the molecular formula C16H26Cl2N4OS and a molecular weight of 393.38 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-(methylamino)butanamide;dihydrochloride.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-(methylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119855271 |
| Molecular Formula | C16H26Cl2N4OS |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-(methylamino)butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)NC(CCSC)c1nc2ccccc2[nH]1.Cl.Cl |
| InChI | InChI=1S/C16H24N4OS.2ClH/c1-17-10-5-8-15(21)18-14(9-11-22-2)16-19-12-6-3-4-7-13(12)20-16;;/h3-4,6-7,14,17H,5,8-11H2,1-2H3,(H,18,21)(H,19,20);2*1H |
| InChIKey | ALRMKLFRLHIYMB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|