C17H25N3OS — CID 46603847
N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]hexanamide (PubChem CID 46603847) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]hexanamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]hexanamide |
|---|---|
| PubChem CID | 46603847 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]hexanamide |
| SMILES | CCCCCC(=O)NC(CCSC)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H25N3OS/c1-3-4-5-10-16(21)18-15(11-12-22-2)17-19-13-8-6-7-9-14(13)20-17/h6-9,15H,3-5,10-12H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | SIQCZUZBBFYZKV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|