C21H25N3OS — CID 2530693
(3S)-N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-3-phenylbutanamide (PubChem CID 2530693) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is (3S)-N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-3-phenylbutanamide.
| Compound Name | (3S)-N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 2530693 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (3S)-N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-3-phenylbutanamide |
| SMILES | CSCC[C@@H](NC(=O)C[C@H](C)c1ccccc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H25N3OS/c1-15(16-8-4-3-5-9-16)14-20(25)22-19(12-13-26-2)21-23-17-10-6-7-11-18(17)24-21/h3-11,15,19H,12-14H2,1-2H3,(H,22,25)(H,23,24)/t15-,19+/m0/s1 |
| InChIKey | XXJHIFSSYDKBBC-HNAYVOBHSA-N |
| XLogP | 4.67 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |