C17H19N3OS2 — CID 2084751
N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-thiophen-2-ylacetamide (PubChem CID 2084751) has the molecular formula C17H19N3OS2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 2084751 |
| Molecular Formula | C17H19N3OS2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-thiophen-2-ylacetamide |
| SMILES | CSCC[C@@H](NC(=O)Cc1cccs1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H19N3OS2/c1-22-10-8-15(18-16(21)11-12-5-4-9-23-12)17-19-13-6-2-3-7-14(13)20-17/h2-7,9,15H,8,10-11H2,1H3,(H,18,21)(H,19,20)/t15-/m1/s1 |
| InChIKey | FTJOMPNOBBSRKJ-OAHLLOKOSA-N |
| XLogP | 3.78 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |