C21H22N4OS — CID 2124947
N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(1H-indol-3-yl)acetamide (PubChem CID 2124947) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 2124947 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(1H-indol-3-yl)acetamide |
| SMILES | CSCC[C@@H](NC(=O)Cc1c[nH]c2ccccc12)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H22N4OS/c1-27-11-10-19(21-24-17-8-4-5-9-18(17)25-21)23-20(26)12-14-13-22-16-7-3-2-6-15(14)16/h2-9,13,19,22H,10-12H2,1H3,(H,23,26)(H,24,25)/t19-/m1/s1 |
| InChIKey | HMZCYKLWEPKJMS-LJQANCHMSA-N |
| XLogP | 4.20 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |