C23H26N4OS — CID 8001336
N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-(1H-indol-3-yl)butanamide (PubChem CID 8001336) has the molecular formula C23H26N4OS and a molecular weight of 406.56 g/mol. Its IUPAC name is N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-(1H-indol-3-yl)butanamide.
| Compound Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-(1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 8001336 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-(1H-indol-3-yl)butanamide |
| SMILES | CSCC[C@H](NC(=O)CCCc1c[nH]c2ccccc12)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H26N4OS/c1-29-14-13-21(23-26-19-10-4-5-11-20(19)27-23)25-22(28)12-6-7-16-15-24-18-9-3-2-8-17(16)18/h2-5,8-11,15,21,24H,6-7,12-14H2,1H3,(H,25,28)(H,26,27)/t21-/m0/s1 |
| InChIKey | WAEYWHRYYLYFOM-NRFANRHFSA-N |
| XLogP | 4.98 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |