C21H25N3OS — CID 51425732
(2R)-N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-phenylbutanamide (PubChem CID 51425732) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is (2R)-N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-phenylbutanamide.
| Compound Name | (2R)-N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 51425732 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (2R)-N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-phenylbutanamide |
| SMILES | CC[C@@H](C(=O)N[C@@H](CCSC)c1nc2ccccc2[nH]1)c1ccccc1 |
| InChI | InChI=1S/C21H25N3OS/c1-3-16(15-9-5-4-6-10-15)21(25)24-19(13-14-26-2)20-22-17-11-7-8-12-18(17)23-20/h4-12,16,19H,3,13-14H2,1-2H3,(H,22,23)(H,24,25)/t16-,19+/m1/s1 |
| InChIKey | WMRKAOMFAFLYIF-APWZRJJASA-N |
| XLogP | 4.67 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |