C21H25N3OS2 — CID 17488325
N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(4-methylphenyl)sulfanylpropanamide (PubChem CID 17488325) has the molecular formula C21H25N3OS2 and a molecular weight of 399.59 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(4-methylphenyl)sulfanylpropanamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(4-methylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 17488325 |
| Molecular Formula | C21H25N3OS2 |
| Molecular Weight | 399.59 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(4-methylphenyl)sulfanylpropanamide |
| SMILES | CSCCC(NC(=O)C(C)Sc1ccc(C)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H25N3OS2/c1-14-8-10-16(11-9-14)27-15(2)21(25)24-19(12-13-26-3)20-22-17-6-4-5-7-18(17)23-20/h4-11,15,19H,12-13H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | GBYNZLOKBRKTEY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |