C20H23N3OS — CID 4807139
N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-ethylbenzamide (PubChem CID 4807139) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-ethylbenzamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 4807139 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)NC(CCSC)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C20H23N3OS/c1-3-14-8-10-15(11-9-14)20(24)23-18(12-13-25-2)19-21-16-6-4-5-7-17(16)22-19/h4-11,18H,3,12-13H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | MCHPWGOAZKVVQR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |