C17H16Cl2N4OS — CID 2128440
N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-5,6-dichloropyridine-3-carboxamide (PubChem CID 2128440) has the molecular formula C17H16Cl2N4OS and a molecular weight of 395.32 g/mol. Its IUPAC name is N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-5,6-dichloropyridine-3-carboxamide.
| Compound Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-5,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 2128440 |
| Molecular Formula | C17H16Cl2N4OS |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-5,6-dichloropyridine-3-carboxamide |
| SMILES | CSCC[C@H](NC(=O)c1cnc(Cl)c(Cl)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H16Cl2N4OS/c1-25-7-6-14(16-21-12-4-2-3-5-13(12)22-16)23-17(24)10-8-11(18)15(19)20-9-10/h2-5,8-9,14H,6-7H2,1H3,(H,21,22)(H,23,24)/t14-/m0/s1 |
| InChIKey | WNUOSNPYOUOZAP-AWEZNQCLSA-N |
| XLogP | 4.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|