C17H17FN4OS — CID 99624790
N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-5-fluoropyridine-3-carboxamide (PubChem CID 99624790) has the molecular formula C17H17FN4OS and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-5-fluoropyridine-3-carboxamide.
| Compound Name | N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 99624790 |
| Molecular Formula | C17H17FN4OS |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-5-fluoropyridine-3-carboxamide |
| SMILES | CSCC[C@@H](NC(=O)c1cncc(F)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H17FN4OS/c1-24-7-6-15(16-20-13-4-2-3-5-14(13)21-16)22-17(23)11-8-12(18)10-19-9-11/h2-5,8-10,15H,6-7H2,1H3,(H,20,21)(H,22,23)/t15-/m1/s1 |
| InChIKey | GHVFIFGVUNVURP-OAHLLOKOSA-N |
| XLogP | 3.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |