C21H22N4OS — CID 86207006
N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-1-methylindole-6-carboxamide (PubChem CID 86207006) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-1-methylindole-6-carboxamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-1-methylindole-6-carboxamide |
|---|---|
| PubChem CID | 86207006 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-1-methylindole-6-carboxamide |
| SMILES | CSCCC(NC(=O)c1ccc2ccn(C)c2c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H22N4OS/c1-25-11-9-14-7-8-15(13-19(14)25)21(26)24-18(10-12-27-2)20-22-16-5-3-4-6-17(16)23-20/h3-9,11,13,18H,10,12H2,1-2H3,(H,22,23)(H,24,26) |
| InChIKey | GXQWFXJZHWKMAW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |