C21H21ClN4OS — CID 118985744
N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(6-chloroindol-1-yl)acetamide (PubChem CID 118985744) has the molecular formula C21H21ClN4OS and a molecular weight of 412.95 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(6-chloroindol-1-yl)acetamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(6-chloroindol-1-yl)acetamide |
|---|---|
| PubChem CID | 118985744 |
| Molecular Formula | C21H21ClN4OS |
| Molecular Weight | 412.95 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(6-chloroindol-1-yl)acetamide |
| SMILES | CSCCC(NC(=O)Cn1ccc2ccc(Cl)cc21)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H21ClN4OS/c1-28-11-9-18(21-24-16-4-2-3-5-17(16)25-21)23-20(27)13-26-10-8-14-6-7-15(22)12-19(14)26/h2-8,10,12,18H,9,11,13H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | WTWINPYGRHDMBD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.95 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |