C21H25N3O3S — CID 2673869
N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(2-ethoxyphenoxy)acetamide (PubChem CID 2673869) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(2-ethoxyphenoxy)acetamide.
| Compound Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(2-ethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 2673869 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-(2-ethoxyphenoxy)acetamide |
| SMILES | CCOc1ccccc1OCC(=O)N[C@@H](CCSC)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H25N3O3S/c1-3-26-18-10-6-7-11-19(18)27-14-20(25)22-17(12-13-28-2)21-23-15-8-4-5-9-16(15)24-21/h4-11,17H,3,12-14H2,1-2H3,(H,22,25)(H,23,24)/t17-/m0/s1 |
| InChIKey | IPGXRNNFNUYPRV-KRWDZBQOSA-N |
| XLogP | 3.95 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |