C19H27N3OS3 — CID 75490995
N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-5-(dithiolan-3-yl)pentanamide (PubChem CID 75490995) has the molecular formula C19H27N3OS3 and a molecular weight of 409.65 g/mol. Its IUPAC name is N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-5-(dithiolan-3-yl)pentanamide.
| Compound Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-5-(dithiolan-3-yl)pentanamide |
|---|---|
| PubChem CID | 75490995 |
| Molecular Formula | C19H27N3OS3 |
| Molecular Weight | 409.65 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-5-(dithiolan-3-yl)pentanamide |
| SMILES | CSCC[C@H](NC(=O)CCCCC1CCSS1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H27N3OS3/c1-24-12-11-17(19-21-15-7-3-4-8-16(15)22-19)20-18(23)9-5-2-6-14-10-13-25-26-14/h3-4,7-8,14,17H,2,5-6,9-13H2,1H3,(H,20,23)(H,21,22)/t14?,17-/m0/s1 |
| InChIKey | IZNBRUYYUCRAQV-JRZJBTRGSA-N |
| XLogP | 5.19 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|