C21H26N4O2S — CID 55430565
N-[4-[[1-(1H-benzimidazol-2-yl)-3-methylbutyl]amino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 55430565) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[4-[[1-(1H-benzimidazol-2-yl)-3-methylbutyl]amino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[[1-(1H-benzimidazol-2-yl)-3-methylbutyl]amino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 55430565 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-[4-[[1-(1H-benzimidazol-2-yl)-3-methylbutyl]amino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | CC(C)CC(NC(=O)CCCNC(=O)c1ccsc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H26N4O2S/c1-14(2)12-18(20-24-16-6-3-4-7-17(16)25-20)23-19(26)8-5-10-22-21(27)15-9-11-28-13-15/h3-4,6-7,9,11,13-14,18H,5,8,10,12H2,1-2H3,(H,22,27)(H,23,26)(H,24,25) |
| InChIKey | OVNXEPLBJCRCAD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|