C24H28N6O3 — CID 91639707
N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-(5,7-dioxopyrrolo[3,4-b]pyrazin-6-yl)hexanamide (PubChem CID 91639707) has the molecular formula C24H28N6O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-(5,7-dioxopyrrolo[3,4-b]pyrazin-6-yl)hexanamide.
| Compound Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-(5,7-dioxopyrrolo[3,4-b]pyrazin-6-yl)hexanamide |
|---|---|
| PubChem CID | 91639707 |
| Molecular Formula | C24H28N6O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-(5,7-dioxopyrrolo[3,4-b]pyrazin-6-yl)hexanamide |
| SMILES | CC(C)C[C@H](NC(=O)CCCCCN1C(=O)c2nccnc2C1=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C24H28N6O3/c1-15(2)14-18(22-28-16-8-5-6-9-17(16)29-22)27-19(31)10-4-3-7-13-30-23(32)20-21(24(30)33)26-12-11-25-20/h5-6,8-9,11-12,15,18H,3-4,7,10,13-14H2,1-2H3,(H,27,31)(H,28,29)/t18-/m0/s1 |
| InChIKey | PPTSINLOBVKPPN-SFHVURJKSA-N |
| XLogP | 3.41 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|