C25H31N5O3S — CID 135996753
N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide (PubChem CID 135996753) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide |
|---|---|
| PubChem CID | 135996753 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide |
| SMILES | CC(C)CC(NC(=O)CCCCC/N=C1\NS(=O)(=O)c2ccccc21)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H31N5O3S/c1-17(2)16-21(25-28-19-11-6-7-12-20(19)29-25)27-23(31)14-4-3-9-15-26-24-18-10-5-8-13-22(18)34(32,33)30-24/h5-8,10-13,17,21H,3-4,9,14-16H2,1-2H3,(H,26,30)(H,27,31)(H,28,29) |
| InChIKey | MUBMNZDECNBKTA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|