C18H20N4O3S — CID 137263923
6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-pyridin-2-ylhexanamide (PubChem CID 137263923) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-pyridin-2-ylhexanamide.
| Compound Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-pyridin-2-ylhexanamide |
|---|---|
| PubChem CID | 137263923 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-pyridin-2-ylhexanamide |
| SMILES | O=C(CCCCC/N=C1\NS(=O)(=O)c2ccccc21)Nc1ccccn1 |
| InChI | InChI=1S/C18H20N4O3S/c23-17(21-16-10-5-7-12-19-16)11-2-1-6-13-20-18-14-8-3-4-9-15(14)26(24,25)22-18/h3-5,7-10,12H,1-2,6,11,13H2,(H,20,22)(H,19,21,23) |
| InChIKey | MUECLHKFUZBNTK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|