C20H22ClN3O3S — CID 135995508
N-(4-chloro-2-methylphenyl)-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide (PubChem CID 135995508) has the molecular formula C20H22ClN3O3S and a molecular weight of 419.93 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide |
|---|---|
| PubChem CID | 135995508 |
| Molecular Formula | C20H22ClN3O3S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)CCCCC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C20H22ClN3O3S/c1-14-13-15(21)10-11-17(14)23-19(25)9-3-2-6-12-22-20-16-7-4-5-8-18(16)28(26,27)24-20/h4-5,7-8,10-11,13H,2-3,6,9,12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | VXLPRXNFTSDAIT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|