C25H32N4O4S — CID 135993446
6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]hexanamide (PubChem CID 135993446) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]hexanamide.
| Compound Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]hexanamide |
|---|---|
| PubChem CID | 135993446 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-methyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]hexanamide |
| SMILES | Cc1cc(C)c(NC(=O)CN(C)C(=O)CCCCC/N=C2\NS(=O)(=O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C25H32N4O4S/c1-17-14-18(2)24(19(3)15-17)27-22(30)16-29(4)23(31)12-6-5-9-13-26-25-20-10-7-8-11-21(20)34(32,33)28-25/h7-8,10-11,14-15H,5-6,9,12-13,16H2,1-4H3,(H,26,28)(H,27,30) |
| InChIKey | IGRHKDXUQUSWCW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|