C21H24N4O4S — CID 135995507
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]propanamide (PubChem CID 135995507) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]propanamide.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 135995507 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]propanamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)CC/N=C2\NS(=O)(=O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C21H24N4O4S/c1-13-10-14(2)20(15(3)11-13)24-19(27)12-23-18(26)8-9-22-21-16-6-4-5-7-17(16)30(28,29)25-21/h4-7,10-11H,8-9,12H2,1-3H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | YBVSUFLUEYIANV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|